Compound Q&A

How is 3-Methylbutyl pentyl phthalate (CAS: 776297-69-9) typically synthesized?

Answer

3-Methylbutyl pentyl phthalate
3-Methylbutyl pentyl phthalate (CAS: 776297-69-9) is usually synthesized through a esterification reaction involving phthalic anhydride and a mixture of 3-methylbutyl alcohol and pentanol. Commonly used catalysts include sulfuric acid or tetra-n-butylammonium hydrogen sulfate. The reaction is carried out at elevated temperatures (around 100°C) under mild pressure conditions, leading to high yield and selectivity.

About

English Name 3-Methylbutyl pentyl phthalate
Molecular Formula C18H26O4
Molecular Weight 306.4 g/mol
SMILES CCCCCOC(=O)C1=CC=CC=C1C(=O)OCCC(C)C
InChIKey MCXWUHMDAJQKBI-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Methylbutyl pentyl phthalate (CAS: 776297-69-9)?

3-Methylbutyl pentyl phthalate (CAS: 776297-69-9) is a clear, colorless liquid with a molecular weig...

Compound Q&A

What industries use 3-Methylbutyl pentyl phthalate (CAS: 776297-69-9)?

3-Methylbutyl pentyl phthalate (CAS: 776297-69-9) is utilized in various industries, including pharm...

Compound Q&A

What precautions should be taken when handling 3-Methylbutyl pentyl phthalate (CAS: 776297-69-9)?

When handling 3-Methylbutyl pentyl phthalate (CAS: 776297-69-9), it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...