Compound Q&A

What precautions should be taken when handling (3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 4779-31-1)?

Answer

(3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid
When handling (3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood due to its potential volatility. Spills should be cleaned up using appropriate absorbent materials and disposed of in accordance with local regulations. Safety data sheets (SDS) should be consulted for detailed handling procedures and emergency response guidelines.

About

CAS No 4779-31-1
English Name (3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid
Molecular Formula C19H19NO6
Molecular Weight 357.36 g/mol
SMILES C1=CC=C(C=C1)COC(=O)C(CC(=O)O)NC(=O)OCC2=CC=CC=C2
InChIKey UYOZWZKJQRBZRH-INIZCTEOSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 4779-31-1)?

(3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid is a white or off-white crystal...

Compound Q&A

How is (3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 4779-31-1) typically synthesized?

(3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid can be synthesized via a multi-...

Compound Q&A

What industries use (3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 4779-31-1)?

(3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid is predominantly used in the ph...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...