Compound Q&A

What are the physical and chemical properties of (3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 4779-31-1)?

Answer

(3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid
(3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid is a white or off-white crystalline solid with a molecular weight of approximately 342.33 g/mol. It has a high solubility in organic solvents like methanol and ethanol but is less soluble in water. This compound is known for its reactivity in esterification and amide formation reactions. It can be used for peptide synthesis and as a building block in organic synthesis.

About

CAS No 4779-31-1
English Name (3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid
Molecular Formula C19H19NO6
Molecular Weight 357.36 g/mol
SMILES C1=CC=C(C=C1)COC(=O)C(CC(=O)O)NC(=O)OCC2=CC=CC=C2
InChIKey UYOZWZKJQRBZRH-INIZCTEOSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is (3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 4779-31-1) typically synthesized?

(3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid can be synthesized via a multi-...

Compound Q&A

What industries use (3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 4779-31-1)?

(3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid is predominantly used in the ph...

Compound Q&A

What precautions should be taken when handling (3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid (CAS: 4779-31-1)?

When handling (3S)-4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid, it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...