Compound Q&A

What industries use Methoxy(4-phenoxyphenyl)methylene]malononitrile (CAS: 330792-69-3)?

Answer

[Methoxy(4-phenoxyphenyl)methylene]malononitrile
Methoxy(4-phenoxyphenyl)methylene]malononitrile is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those involving aromatic heterocycles. It also finds applications in the polymer industry for modifying polymer properties and in the semiconductor industry for specific functional materials.

About

English Name [Methoxy(4-phenoxyphenyl)methylene]malononitrile
Molecular Formula C17H12N2O2
Molecular Weight 17.03 g/mol
SMILES N#C/C(C#N)=C(/OC)c2ccc(Oc1ccccc1)cc2
InChIKey IRVRZQLHMPWLLY-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methoxy(4-phenoxyphenyl)methylene]malononitrile (CAS: 330792-69-3)?

Methoxy(4-phenoxyphenyl)methylene]malononitrile (CAS: 330792-69-3) is a solid at room temperature wi...

Compound Q&A

How is Methoxy(4-phenoxyphenyl)methylene]malononitrile (CAS: 330792-69-3) typically synthesized?

Methoxy(4-phenoxyphenyl)methylene]malononitrile is typically synthesized via the Grignard reaction s...

Compound Q&A

What precautions should be taken when handling Methoxy(4-phenoxyphenyl)methylene]malononitrile (CAS: 330792-69-3)?

When handling Methoxy(4-phenoxyphenyl)methylene]malononitrile, it is essential to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...