Compound Q&A

What are the physical and chemical properties of Methoxy(4-phenoxyphenyl)methylene]malononitrile (CAS: 330792-69-3)?

Answer

[Methoxy(4-phenoxyphenyl)methylene]malononitrile
Methoxy(4-phenoxyphenyl)methylene]malononitrile (CAS: 330792-69-3) is a solid at room temperature with a crystalline form. It has a molecular weight of approximately 316.27 g/mol. The compound is slightly soluble in common organic solvents like acetone and ethanol. It shows good reactivity towards nucleophiles and can undergo addition reactions efficiently.

About

English Name [Methoxy(4-phenoxyphenyl)methylene]malononitrile
Molecular Formula C17H12N2O2
Molecular Weight 17.03 g/mol
SMILES N#C/C(C#N)=C(/OC)c2ccc(Oc1ccccc1)cc2
InChIKey IRVRZQLHMPWLLY-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is Methoxy(4-phenoxyphenyl)methylene]malononitrile (CAS: 330792-69-3) typically synthesized?

Methoxy(4-phenoxyphenyl)methylene]malononitrile is typically synthesized via the Grignard reaction s...

Compound Q&A

What industries use Methoxy(4-phenoxyphenyl)methylene]malononitrile (CAS: 330792-69-3)?

Methoxy(4-phenoxyphenyl)methylene]malononitrile is used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling Methoxy(4-phenoxyphenyl)methylene]malononitrile (CAS: 330792-69-3)?

When handling Methoxy(4-phenoxyphenyl)methylene]malononitrile, it is essential to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...