Compound Q&A

What precautions should be taken when handling 4-Acetamido-2-aminobenzenesulfonic acid (CAS: 88-64-2)?

Answer

4-Acetamido-2-aminobenzenesulfonic acid
When handling 4-Acetamido-2-aminobenzenesulfonic acid, it is crucial to wear personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood to minimize exposure. In case of a spill, it should be cleaned up promptly using appropriate materials, and the area should be thoroughly rinsed with water. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal procedures.

About

CAS No 88-64-2
English Name 4-Acetamido-2-aminobenzenesulfonic acid
Molecular Formula C8H10N2O4S
Molecular Weight 230.24 g/mol
SMILES CC(=O)NC1=CC(=C(C=C1)S(=O)(=O)O)N
InChIKey FOINSAWEWXUXPQ-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Acetamido-2-aminobenzenesulfonic acid (CAS: 88-64-2)?

4-Acetamido-2-aminobenzenesulfonic acid is a white crystalline solid with a molecular weight of appr...

Compound Q&A

How is 4-Acetamido-2-aminobenzenesulfonic acid (CAS: 88-64-2) typically synthesized?

4-Acetamido-2-aminobenzenesulfonic acid is typically synthesized via the sulfonation of 4-acetamido-...

Compound Q&A

What industries use 4-Acetamido-2-aminobenzenesulfonic acid (CAS: 88-64-2)?

4-Acetamido-2-aminobenzenesulfonic acid is primarily used in the pharmaceutical industry as a precur...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...