Compound Q&A

What are the physical and chemical properties of 4-Acetamido-2-aminobenzenesulfonic acid (CAS: 88-64-2)?

Answer

4-Acetamido-2-aminobenzenesulfonic acid
4-Acetamido-2-aminobenzenesulfonic acid is a white crystalline solid with a molecular weight of approximately 250.24 g/mol. It has a solubility of about 3.6 g/L in water at 25°C. Chemically, it is highly reactive, particularly in acidic or basic conditions, and can undergo various reactions such as esterification and sulfonation.

About

CAS No 88-64-2
English Name 4-Acetamido-2-aminobenzenesulfonic acid
Molecular Formula C8H10N2O4S
Molecular Weight 230.24 g/mol
SMILES CC(=O)NC1=CC(=C(C=C1)S(=O)(=O)O)N
InChIKey FOINSAWEWXUXPQ-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 4-Acetamido-2-aminobenzenesulfonic acid (CAS: 88-64-2) typically synthesized?

4-Acetamido-2-aminobenzenesulfonic acid is typically synthesized via the sulfonation of 4-acetamido-...

Compound Q&A

What industries use 4-Acetamido-2-aminobenzenesulfonic acid (CAS: 88-64-2)?

4-Acetamido-2-aminobenzenesulfonic acid is primarily used in the pharmaceutical industry as a precur...

Compound Q&A

What precautions should be taken when handling 4-Acetamido-2-aminobenzenesulfonic acid (CAS: 88-64-2)?

When handling 4-Acetamido-2-aminobenzenesulfonic acid, it is crucial to wear personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...