Compound Q&A

What precautions should be taken when handling Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9)?

Answer

Zinc 1,2-propanediyldicarbamodithioate
When handling Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9), appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. Work should be conducted in a well-ventilated area or fume hood. In case of a spill, immediately use appropriate spill response materials and consult the Safety Data Sheet (SDS) for specific procedures. It is crucial to ensure proper storage and disposal to prevent environmental contamination and ensure worker safety.

About

CAS No 12071-83-9
English Name Zinc 1,2-propanediyldicarbamodithioate
Molecular Formula C5H8N2S4Zn
Molecular Weight 289.77 g/mol
SMILES [S-]C(=S)NCC(NC(=S)[S-])C.[Zn+2]
InChIKey KKMLIVYBGSAJPM-UHFFFAOYSA-L
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9)?

Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9) is a crystalline compound with a molecular ...

Compound Q&A

How is Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9) typically synthesized?

Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9) is typically synthesized via the reaction o...

Compound Q&A

What industries use Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9)?

Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9) is used in various industries, including ph...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...