Compound Q&A

What industries use Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9)?

Answer

Zinc 1,2-propanediyldicarbamodithioate
Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9) is used in various industries, including pharmaceuticals for its antioxidant properties, polymers as a stabilizer, sensors for detecting sulfur compounds, and semiconductors for its unique electronic properties. Its reactivity and functional groups make it a valuable compound in these applications.

About

CAS No 12071-83-9
English Name Zinc 1,2-propanediyldicarbamodithioate
Molecular Formula C5H8N2S4Zn
Molecular Weight 289.77 g/mol
SMILES [S-]C(=S)NCC(NC(=S)[S-])C.[Zn+2]
InChIKey KKMLIVYBGSAJPM-UHFFFAOYSA-L
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9)?

Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9) is a crystalline compound with a molecular ...

Compound Q&A

How is Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9) typically synthesized?

Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9) is typically synthesized via the reaction o...

Compound Q&A

What precautions should be taken when handling Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9)?

When handling Zinc 1,2-propanediyldicarbamodithioate (CAS: 12071-83-9), appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...