Compound Q&A

How is 2-Chloro-4-methoxy-5-nitropyridine (CAS: 607373-83-1) typically synthesized?

Answer

2-Chloro-4-methoxy-5-nitropyridine
2-Chloro-4-methoxy-5-nitropyridine is synthesized through a multistep process starting with chloropyridine. It involves the reaction of chloropyridine with methanol in the presence of a suitable catalyst, followed by nitration. The overall yield can vary, but efficient methods can achieve up to 85% yield.

About

English Name 2-Chloro-4-methoxy-5-nitropyridine
Molecular Formula C6H5ClN2O3
Molecular Weight 188.57 g/mol
SMILES COC1=CC(=NC=C1[N+](=O)[O-])Cl
InChIKey IDLQBYAYVNBGGL-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-4-methoxy-5-nitropyridine (CAS: 607373-83-1)?

2-Chloro-4-methoxy-5-nitropyridine (CAS: 607373-83-1) is a crystalline solid with a molecular weight...

Compound Q&A

What industries use 2-Chloro-4-methoxy-5-nitropyridine (CAS: 607373-83-1)?

2-Chloro-4-methoxy-5-nitropyridine (CAS: 607373-83-1) finds applications in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 2-Chloro-4-methoxy-5-nitropyridine (CAS: 607373-83-1)?

When handling 2-Chloro-4-methoxy-5-nitropyridine (CAS: 607373-83-1), proper personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...