Compound Q&A

What are the physical and chemical properties of 2-Chloro-4-methoxy-5-nitropyridine (CAS: 607373-83-1)?

Answer

2-Chloro-4-methoxy-5-nitropyridine
2-Chloro-4-methoxy-5-nitropyridine (CAS: 607373-83-1) is a crystalline solid with a molecular weight of approximately 226.04 g/mol. It has limited water solubility and is more soluble in organic solvents like ethanol and acetone. This compound is known for its high reactivity, particularly towards nucleophiles and reducing agents.

About

English Name 2-Chloro-4-methoxy-5-nitropyridine
Molecular Formula C6H5ClN2O3
Molecular Weight 188.57 g/mol
SMILES COC1=CC(=NC=C1[N+](=O)[O-])Cl
InChIKey IDLQBYAYVNBGGL-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 2-Chloro-4-methoxy-5-nitropyridine (CAS: 607373-83-1) typically synthesized?

2-Chloro-4-methoxy-5-nitropyridine is synthesized through a multistep process starting with chloropy...

Compound Q&A

What industries use 2-Chloro-4-methoxy-5-nitropyridine (CAS: 607373-83-1)?

2-Chloro-4-methoxy-5-nitropyridine (CAS: 607373-83-1) finds applications in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 2-Chloro-4-methoxy-5-nitropyridine (CAS: 607373-83-1)?

When handling 2-Chloro-4-methoxy-5-nitropyridine (CAS: 607373-83-1), proper personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...