Compound Q&A

What industries use 1,3,5-Triazine-2,4,6-triamine, phosphate (CAS: 218768-84-4)?

Answer

1,3,5-Triazine-2,4,6-triamine, phosphate
1,3,5-Triazine-2,4,6-triamine, phosphate is mainly used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the polymer industry for the modification of polymers to enhance their mechanical and thermal properties. Additionally, it has applications in the semiconductor industry for the fabrication of sensors and other electronic components.

About

English Name 1,3,5-Triazine-2,4,6-triamine, phosphate
Molecular Formula C3H9N6O4P
Molecular Weight 224.12 g/mol
SMILES C1(=NC(=NC(=N1)N)N)N.OP(=O)(O)O
InChIKey XFZRQAZGUOTJCS-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3,5-Triazine-2,4,6-triamine, phosphate (CAS: 218768-84-4)?

1,3,5-Triazine-2,4,6-triamine, phosphate is a white or off-white solid with a crystalline form. Its ...

Compound Q&A

How is 1,3,5-Triazine-2,4,6-triamine, phosphate (CAS: 218768-84-4) typically synthesized?

1,3,5-Triazine-2,4,6-triamine, phosphate is typically synthesized by the reaction of 1,3,5-triazine-...

Compound Q&A

What precautions should be taken when handling 1,3,5-Triazine-2,4,6-triamine, phosphate (CAS: 218768-84-4)?

When handling 1,3,5-Triazine-2,4,6-triamine, phosphate, it is essential to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...