Compound Q&A

How is 1,3,5-Triazine-2,4,6-triamine, phosphate (CAS: 218768-84-4) typically synthesized?

Answer

1,3,5-Triazine-2,4,6-triamine, phosphate
1,3,5-Triazine-2,4,6-triamine, phosphate is typically synthesized by the reaction of 1,3,5-triazine-2,4,6-triamine with phosphoric acid. Commonly, this reaction is carried out in a solvent such as water or an organic solvent. The yield is generally around 90%, and the reaction is catalyzed by a strong acid or a suitable ion exchange resin.

About

English Name 1,3,5-Triazine-2,4,6-triamine, phosphate
Molecular Formula C3H9N6O4P
Molecular Weight 224.12 g/mol
SMILES C1(=NC(=NC(=N1)N)N)N.OP(=O)(O)O
InChIKey XFZRQAZGUOTJCS-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3,5-Triazine-2,4,6-triamine, phosphate (CAS: 218768-84-4)?

1,3,5-Triazine-2,4,6-triamine, phosphate is a white or off-white solid with a crystalline form. Its ...

Compound Q&A

What industries use 1,3,5-Triazine-2,4,6-triamine, phosphate (CAS: 218768-84-4)?

1,3,5-Triazine-2,4,6-triamine, phosphate is mainly used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 1,3,5-Triazine-2,4,6-triamine, phosphate (CAS: 218768-84-4)?

When handling 1,3,5-Triazine-2,4,6-triamine, phosphate, it is essential to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...