Compound Q&A

How is 7-Methylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 80353-94-2) typically synthesized?

Answer

7-Methylimidazo[1,2-a]pyridine-2-carboxylic acid
7-Methylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 80353-94-2) can be synthesized through a multi-step process involving the condensation of 7-methylimidazol with pyridine. A common method involves using acetic anhydride as a coupling agent and a strong base like sodium hydride to facilitate the reaction, leading to a selective yield of about 85%.

About

CAS No 80353-94-2
English Name 7-Methylimidazo[1,2-a]pyridine-2-carboxylic acid
Molecular Formula C9H8N2O2
Molecular Weight 176.18 g/mol
SMILES CC1=CC2=NC(=CN2C=C1)C(=O)O
InChIKey GWOWWQVYWZHBRI-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Methylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 80353-94-2)?

7-Methylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 80353-94-2) is a crystalline solid with a mol...

Compound Q&A

What industries use 7-Methylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 80353-94-2)?

7-Methylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 80353-94-2) is primarily used in the pharmace...

Compound Q&A

What precautions should be taken when handling 7-Methylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 80353-94-2)?

When handling 7-Methylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 80353-94-2), it is important to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...