Compound Q&A

What are the physical and chemical properties of 6-chloro-1-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol, methanesulfonic acid (CAS: 67227-57-0)?

Answer

6-chloro-1-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol, methanesulfonic acid
This compound is a crystalline solid with a molecular weight of approximately 463.8 g/mol. It has poor water solubility but good solubility in organic solvents. Chemically, it is highly reactive due to the presence of a methanesulfonic acid moiety and a phenolic hydroxyl group. It is less reactive towards basic conditions but can undergo hydrolysis under acidic conditions.

About

CAS No 67227-57-0
English Name 6-chloro-1-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol, methanesulfonic acid
Molecular Formula C17H20ClNO6S
Molecular Weight 401.87 g/mol
SMILES CS(=O)(=O)O.C1CNCC(C2=CC(=C(C(=C21)Cl)O)O)C3=CC=C(C=C3)O
InChIKey CVKUMNRCIJMVAR-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 6-chloro-1-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol, methanesulfonic acid (CAS: 67227-57-0) typically synthesized?

The compound is typically synthesized via the methylation of 6-chloro-1-(4-hydroxyphenyl)-2,3,4,5-te...

Compound Q&A

What industries use 6-chloro-1-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol, methanesulfonic acid (CAS: 67227-57-0)?

This compound is primarily used in the pharmaceutical industry for the synthesis of certain drugs. I...

Compound Q&A

What precautions should be taken when handling 6-chloro-1-(4-hydroxyphenyl)-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol, methanesulfonic acid (CAS: 67227-57-0)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...