Compound Q&A

What industries use 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate (CAS: 3030-06-6)?

Answer

1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate
1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate is primarily used in the pharmaceutical industry for the synthesis of novel indole-based drugs. It also finds applications in the research of organic materials for sensors and semiconductors due to its unique chemical structure and reactivity.

About

CAS No 3030-06-6
English Name 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate
Molecular Formula C12H9BrClNO3
Molecular Weight 330.57 g/mol
SMILES CC(=O)N1C=C(C2=C1C=CC(=C2Cl)Br)OC(=O)C
InChIKey DSHQTSIXXYZXGR-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate (CAS: 3030-06-6)?

1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate (CAS: 3030-06-6) typically synthesized?

1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate is typically synthesized through a multistep process...

Compound Q&A

What precautions should be taken when handling 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate (CAS: 3030-06-6)?

When handling 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate, wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...