Compound Q&A

What are the physical and chemical properties of 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate (CAS: 3030-06-6)?

Answer

1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate
1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate is a crystalline solid with a molecular weight of approximately 366.05 g/mol. It has limited water solubility and high solubility in organic solvents such as methanol and acetonitrile. The compound exhibits moderate reactivity towards nucleophiles and can undergo substitution reactions. It is stable under normal conditions but should be stored in a dry, cool place away from direct sunlight.

About

CAS No 3030-06-6
English Name 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate
Molecular Formula C12H9BrClNO3
Molecular Weight 330.57 g/mol
SMILES CC(=O)N1C=C(C2=C1C=CC(=C2Cl)Br)OC(=O)C
InChIKey DSHQTSIXXYZXGR-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate (CAS: 3030-06-6) typically synthesized?

1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate is typically synthesized through a multistep process...

Compound Q&A

What industries use 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate (CAS: 3030-06-6)?

1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate is primarily used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate (CAS: 3030-06-6)?

When handling 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate, wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...