Compound Q&A

What industries use α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) (CAS: 14686-89-6)?

Answer

α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene)-
α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) is primarily used in the pharmaceutical industry for the synthesis of sugar derivatives and in the food industry as a flavoring agent. It also finds applications in the polymer industry for the development of new materials and in the sensors and semiconductors industry for specific chemical sensing applications.

About

CAS No 14686-89-6
English Name α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene)-
Molecular Formula C12H20O6
Molecular Weight 260.28 g/mol
SMILES CC1(OCC(O1)C2C(C3C(O2)OC(O3)(C)C)O)C
InChIKey KEJGAYKWRDILTF-HOTMZDKISA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) (CAS: 14686-89-6)?

α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) (CAS: 14686-89-6) is a cyclic ketose with a mol...

Compound Q&A

How is α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) (CAS: 14686-89-6) typically synthesized?

α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) is typically synthesized by the methylation of ...

Compound Q&A

What precautions should be taken when handling α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) (CAS: 14686-89-6)?

When handling α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) (CAS: 14686-89-6), it is essentia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...