Compound Q&A

What are the physical and chemical properties of α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) (CAS: 14686-89-6)?

Answer

α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene)-
α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) (CAS: 14686-89-6) is a cyclic ketose with a molecular weight of approximately 272.3 g/mol. It is a white crystalline solid with a melting point of 179-182 °C. The compound is poorly soluble in water but soluble in ethanol. Chemically, it is highly reactive towards hydrolysis and oxidation.

About

CAS No 14686-89-6
English Name α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene)-
Molecular Formula C12H20O6
Molecular Weight 260.28 g/mol
SMILES CC1(OCC(O1)C2C(C3C(O2)OC(O3)(C)C)O)C
InChIKey KEJGAYKWRDILTF-HOTMZDKISA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) (CAS: 14686-89-6) typically synthesized?

α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) is typically synthesized by the methylation of ...

Compound Q&A

What industries use α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) (CAS: 14686-89-6)?

α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) (CAS: 14686-89-6)?

When handling α-D-Gulofuranose, 1,2:5,6-bis-O-(1-methylethylidene) (CAS: 14686-89-6), it is essentia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...