Compound Q&A

What industries use Methyl 4-[(1S)-1-aminoethyl]benzoate (CAS: 222714-37-6)?

Answer

Methyl 4-[(1S)-1-aminoethyl]benzoate
Methyl 4-[(1S)-1-aminoethyl]benzoate (CAS: 222714-37-6) is used in the pharmaceutical industry for the synthesis of various biologically active compounds. It also finds applications in the polymer industry as a monomer and in the development of sensor devices. Additionally, it is utilized in the semiconductor industry due to its specific functional groups that can be exploited for various surface modifications.

About

English Name Methyl 4-[(1S)-1-aminoethyl]benzoate
Molecular Formula C10H13NO2
Molecular Weight 179.22 g/mol
SMILES CC(C1=CC=C(C=C1)C(=O)OC)N
InChIKey XSYGLHLLQZGWPT-ZETCQYMHSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-[(1S)-1-aminoethyl]benzoate (CAS: 222714-37-6)?

Methyl 4-[(1S)-1-aminoethyl]benzoate (CAS: 222714-37-6) is a white crystalline solid with a molecula...

Compound Q&A

How is Methyl 4-[(1S)-1-aminoethyl]benzoate (CAS: 222714-37-6) typically synthesized?

Methyl 4-[(1S)-1-aminoethyl]benzoate (CAS: 222714-37-6) is synthesized through the condensation of b...

Compound Q&A

What precautions should be taken when handling Methyl 4-[(1S)-1-aminoethyl]benzoate (CAS: 222714-37-6)?

When handling Methyl 4-[(1S)-1-aminoethyl]benzoate (CAS: 222714-37-6), it is important to use approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...