Compound Q&A

How is 9-Oxo-9H-fluorene-4-carboxylic acid (CAS: 6223-83-2) typically synthesized?

Answer

9-Oxo-9H-fluorene-4-carboxylic acid
9-Oxo-9H-fluorene-4-carboxylic acid can be synthesized via the oxidation of 9H-fluorene-4-carboxylic acid. Common methods include the use of peroxyacids like peracetic acid or sodium hypochlorite in aqueous media. The reaction typically provides high yields and good selectivity, making it a reliable method for industrial production.

About

CAS No 6223-83-2
English Name 9-Oxo-9H-fluorene-4-carboxylic acid
Molecular Formula C14H8O3
Molecular Weight 224.21 g/mol
SMILES C1=CC=C2C(=C1)C3=C(C2=O)C=CC=C3C(=O)O
InChIKey AFQYQSWTVCNJQT-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9-Oxo-9H-fluorene-4-carboxylic acid (CAS: 6223-83-2)?

9-Oxo-9H-fluorene-4-carboxylic acid is a white crystalline solid with a molecular weight of approxim...

Compound Q&A

What industries use 9-Oxo-9H-fluorene-4-carboxylic acid (CAS: 6223-83-2)?

9-Oxo-9H-fluorene-4-carboxylic acid is primarily used in the pharmaceutical industry as a starting m...

Compound Q&A

What precautions should be taken when handling 9-Oxo-9H-fluorene-4-carboxylic acid (CAS: 6223-83-2)?

Proper handling of 9-Oxo-9H-fluorene-4-carboxylic acid requires the use of personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...