Compound Q&A

What are the physical and chemical properties of 9-Oxo-9H-fluorene-4-carboxylic acid (CAS: 6223-83-2)?

Answer

9-Oxo-9H-fluorene-4-carboxylic acid
9-Oxo-9H-fluorene-4-carboxylic acid is a white crystalline solid with a molecular weight of approximately 259.21 g/mol. It has a high melting point around 220°C and is slightly soluble in water. This compound is reactive towards nucleophiles and can form esters and amides. It exhibits good solubility in organic solvents like dichloromethane and acetonitrile, making it useful in various chemical reactions.

About

CAS No 6223-83-2
English Name 9-Oxo-9H-fluorene-4-carboxylic acid
Molecular Formula C14H8O3
Molecular Weight 224.21 g/mol
SMILES C1=CC=C2C(=C1)C3=C(C2=O)C=CC=C3C(=O)O
InChIKey AFQYQSWTVCNJQT-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 9-Oxo-9H-fluorene-4-carboxylic acid (CAS: 6223-83-2) typically synthesized?

9-Oxo-9H-fluorene-4-carboxylic acid can be synthesized via the oxidation of 9H-fluorene-4-carboxylic...

Compound Q&A

What industries use 9-Oxo-9H-fluorene-4-carboxylic acid (CAS: 6223-83-2)?

9-Oxo-9H-fluorene-4-carboxylic acid is primarily used in the pharmaceutical industry as a starting m...

Compound Q&A

What precautions should be taken when handling 9-Oxo-9H-fluorene-4-carboxylic acid (CAS: 6223-83-2)?

Proper handling of 9-Oxo-9H-fluorene-4-carboxylic acid requires the use of personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...