Compound Q&A

How is Azure A chloride (CAS: 531-53-3) typically synthesized?

Answer

Azure A chloride
Azure A chloride is synthesized by reacting Azure A with hydrochloric acid. Common methods involve the use of concentrated HCl or fuming HCl. The reaction is typically carried out in a closed vessel under mildly acidic conditions to prevent decomposition. The yield is around 85-90% with good selectivity.

About

CAS No 531-53-3
English Name Azure A chloride
Molecular Formula C14H14ClN3S
Molecular Weight 291.8 g/mol
SMILES C[N+](=C1C=CC2=NC3=C(C=C(C=C3)N)SC2=C1)C.[Cl-]
InChIKey NALREUIWICQLPS-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Azure A chloride (CAS: 531-53-3)?

Azure A chloride is a crystalline compound with a molecular weight of approximately 472.88 g/mol. It...

Compound Q&A

What industries use Azure A chloride (CAS: 531-53-3)?

Azure A chloride is widely used in the pharmaceutical industry for dyeing tablets and capsules. It i...

Compound Q&A

What precautions should be taken when handling Azure A chloride (CAS: 531-53-3)?

When handling Azure A chloride, appropriate personal protective equipment (PPE) such as safety goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...