Compound Q&A

What are the physical and chemical properties of Azure A chloride (CAS: 531-53-3)?

Answer

Azure A chloride
Azure A chloride is a crystalline compound with a molecular weight of approximately 472.88 g/mol. It has a high solubility in common organic solvents like ethanol and acetone but is practically insoluble in water. Chemically, it is relatively stable but can react with strong bases to form insoluble precipitates. Its color is a vibrant blue, which is characteristic of the dye.

About

CAS No 531-53-3
English Name Azure A chloride
Molecular Formula C14H14ClN3S
Molecular Weight 291.8 g/mol
SMILES C[N+](=C1C=CC2=NC3=C(C=C(C=C3)N)SC2=C1)C.[Cl-]
InChIKey NALREUIWICQLPS-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is Azure A chloride (CAS: 531-53-3) typically synthesized?

Azure A chloride is synthesized by reacting Azure A with hydrochloric acid. Common methods involve t...

Compound Q&A

What industries use Azure A chloride (CAS: 531-53-3)?

Azure A chloride is widely used in the pharmaceutical industry for dyeing tablets and capsules. It i...

Compound Q&A

What precautions should be taken when handling Azure A chloride (CAS: 531-53-3)?

When handling Azure A chloride, appropriate personal protective equipment (PPE) such as safety goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...