Compound Q&A

What precautions should be taken when handling 3-alpha-O-acetyl-alpha-boswellic acid (CAS: 89913-60-0)?

Answer

3-alpha-O-acetyl-alpha-boswellic acid
When handling 3-alpha-O-acetyl-alpha-boswellic acid (CAS: 89913-60-0), it is important to use appropriate personal protective equipment (PPE) such as gloves and goggles. Ensure adequate ventilation and work in a fume hood. In case of spill, neutralize with an appropriate solution and dispose of according to local regulations. Always refer to the safety data sheet (SDS) for detailed safety information.

About

CAS No 89913-60-0
English Name 3-alpha-O-acetyl-alpha-boswellic acid
Molecular Formula C32H50O4
Molecular Weight 498.74 g/mol
SMILES CC(=O)OC1CCC2(C(C1(C)C(=O)O)CCC3(C2CC=C4C3(CCC5(C4CC(CC5)(C)C)C)C)C)C
InChIKey IAWGZKRQDHPFCZ-OBHGTAHRSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-alpha-O-acetyl-alpha-boswellic acid (CAS: 89913-60-0)?

3-alpha-O-acetyl-alpha-boswellic acid (CAS: 89913-60-0) is a crystalline solid with a molecular weig...

Compound Q&A

How is 3-alpha-O-acetyl-alpha-boswellic acid (CAS: 89913-60-0) typically synthesized?

3-alpha-O-acetyl-alpha-boswellic acid is typically synthesized through a multi-step process involvin...

Compound Q&A

What industries use 3-alpha-O-acetyl-alpha-boswellic acid (CAS: 89913-60-0)?

3-alpha-O-acetyl-alpha-boswellic acid (CAS: 89913-60-0) is primarily used in the pharmaceutical indu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...