Compound Q&A

How is 3-alpha-O-acetyl-alpha-boswellic acid (CAS: 89913-60-0) typically synthesized?

Answer

3-alpha-O-acetyl-alpha-boswellic acid
3-alpha-O-acetyl-alpha-boswellic acid is typically synthesized through a multi-step process involving the acetylation of alpha-boswellic acid. The reaction is catalyzed by a strong acid like triflic acid, with a high selectivity and yield, often around 80-90%.

About

CAS No 89913-60-0
English Name 3-alpha-O-acetyl-alpha-boswellic acid
Molecular Formula C32H50O4
Molecular Weight 498.74 g/mol
SMILES CC(=O)OC1CCC2(C(C1(C)C(=O)O)CCC3(C2CC=C4C3(CCC5(C4CC(CC5)(C)C)C)C)C)C
InChIKey IAWGZKRQDHPFCZ-OBHGTAHRSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-alpha-O-acetyl-alpha-boswellic acid (CAS: 89913-60-0)?

3-alpha-O-acetyl-alpha-boswellic acid (CAS: 89913-60-0) is a crystalline solid with a molecular weig...

Compound Q&A

What industries use 3-alpha-O-acetyl-alpha-boswellic acid (CAS: 89913-60-0)?

3-alpha-O-acetyl-alpha-boswellic acid (CAS: 89913-60-0) is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 3-alpha-O-acetyl-alpha-boswellic acid (CAS: 89913-60-0)?

When handling 3-alpha-O-acetyl-alpha-boswellic acid (CAS: 89913-60-0), it is important to use approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...