Compound Q&A

What precautions should be taken when handling Pyrrole-2,3,5-tricarboxylic acid (CAS: 945-32-4)?

Answer

Pyrrole-2,3,5-tricarboxylic acid
When handling Pyrrole-2,3,5-tricarboxylic acid (CAS: 945-32-4), it is crucial to use personal protective equipment (PPE) such as gloves, goggles, and lab coats. Work in a fume hood to minimize inhalation risks. Spills should be cleaned up carefully to avoid skin contact, and proper waste disposal procedures should be followed. Always consult the Safety Data Sheet (SDS) for detailed handling instructions.

About

CAS No 945-32-4
English Name Pyrrole-2,3,5-tricarboxylic acid
Molecular Formula C7H5NO6
Molecular Weight 199.12 g/mol
SMILES C1=C(NC(=C1C(=O)O)C(=O)O)C(=O)O
InChIKey UGSAVTSXHXRENH-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pyrrole-2,3,5-tricarboxylic acid (CAS: 945-32-4)?

Pyrrole-2,3,5-tricarboxylic acid (CAS: 945-32-4) is a crystalline solid with a molecular weight of a...

Compound Q&A

How is Pyrrole-2,3,5-tricarboxylic acid (CAS: 945-32-4) typically synthesized?

Pyrrole-2,3,5-tricarboxylic acid is synthesized through the condensation of pyrrole-2-carboxylic aci...

Compound Q&A

What industries use Pyrrole-2,3,5-tricarboxylic acid (CAS: 945-32-4)?

Pyrrole-2,3,5-tricarboxylic acid (CAS: 945-32-4) is used in the pharmaceutical industry for drug syn...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...