Compound Q&A

What are the physical and chemical properties of Pyrrole-2,3,5-tricarboxylic acid (CAS: 945-32-4)?

Answer

Pyrrole-2,3,5-tricarboxylic acid
Pyrrole-2,3,5-tricarboxylic acid (CAS: 945-32-4) is a crystalline solid with a molecular weight of approximately 234.11 g/mol. It is soluble in water and less soluble in organic solvents. This compound is known for its acidic nature and forms colorless to white crystals. It is moderately reactive, particularly in acid-base reactions and esterification processes.

About

CAS No 945-32-4
English Name Pyrrole-2,3,5-tricarboxylic acid
Molecular Formula C7H5NO6
Molecular Weight 199.12 g/mol
SMILES C1=C(NC(=C1C(=O)O)C(=O)O)C(=O)O
InChIKey UGSAVTSXHXRENH-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is Pyrrole-2,3,5-tricarboxylic acid (CAS: 945-32-4) typically synthesized?

Pyrrole-2,3,5-tricarboxylic acid is synthesized through the condensation of pyrrole-2-carboxylic aci...

Compound Q&A

What industries use Pyrrole-2,3,5-tricarboxylic acid (CAS: 945-32-4)?

Pyrrole-2,3,5-tricarboxylic acid (CAS: 945-32-4) is used in the pharmaceutical industry for drug syn...

Compound Q&A

What precautions should be taken when handling Pyrrole-2,3,5-tricarboxylic acid (CAS: 945-32-4)?

When handling Pyrrole-2,3,5-tricarboxylic acid (CAS: 945-32-4), it is crucial to use personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...