Compound Q&A

How is N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-D-phenylalanine (CAS: 82317-83-7) typically synthesized?

Answer

N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-D-phenylalanine
This compound is synthesized via a multi-step process that includes protection of the D-phenylalanine, introduction of the trifluoromethyl group, and formation of the ester linkage. Commonly used catalysts include esters of carboxylic acids. The synthesis typically yields high purity products with good selectivity and yield, making it suitable for commercial production.

About

CAS No 82317-83-7
English Name N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-D-phenylalanine
Molecular Formula C15H18F3NO4
Molecular Weight 333.31 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)C(F)(F)F)C(=O)O
InChIKey SMVCCWNHCHCWAZ-LLVKDONJSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-D-phenylalanine (CAS: 82317-83-7)?

This compound is a solid with a crystalline form. It has a high molecular weight due to its complex ...

Compound Q&A

What industries use N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-D-phenylalanine (CAS: 82317-83-7)?

This compound is primarily used in the pharmaceutical industry, particularly in the development of a...

Compound Q&A

What precautions should be taken when handling N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-D-phenylalanine (CAS: 82317-83-7)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...