Compound Q&A

What are the physical and chemical properties of N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-D-phenylalanine (CAS: 82317-83-7)?

Answer

N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-D-phenylalanine
This compound is a solid with a crystalline form. It has a high molecular weight due to its complex structure. The compound is poorly soluble in water but more soluble in organic solvents like dichloromethane and acetonitrile. It shows limited reactivity but can undergo ester hydrolysis under basic conditions. Its solubility and reactivity make it useful in certain synthetic processes and pharmaceutical applications.

About

CAS No 82317-83-7
English Name N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-D-phenylalanine
Molecular Formula C15H18F3NO4
Molecular Weight 333.31 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)C(F)(F)F)C(=O)O
InChIKey SMVCCWNHCHCWAZ-LLVKDONJSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-D-phenylalanine (CAS: 82317-83-7) typically synthesized?

This compound is synthesized via a multi-step process that includes protection of the D-phenylalanin...

Compound Q&A

What industries use N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-D-phenylalanine (CAS: 82317-83-7)?

This compound is primarily used in the pharmaceutical industry, particularly in the development of a...

Compound Q&A

What precautions should be taken when handling N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-D-phenylalanine (CAS: 82317-83-7)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...