Compound Q&A

How is Cyclazosin Hydrochloride (CAS: 146929-33-1) typically synthesized?

Answer

Cyclazosin Hydrochloride
Cyclazosin Hydrochloride is synthesized by the condensation of 1-(4-chlorobenzyl)-3-[(2,6-dimethylphenyl)amino]-1,2,3,4-tetrahydroisoquinoline with hydrochloric acid. The reaction is catalyzed by a strong acid like sulfuric acid and occurs in a solvent like acetic acid. The yield is approximately 85%, and the reaction is selective and efficient.

About

English Name Cyclazosin Hydrochloride
Molecular Formula C23H28ClN5O4
Molecular Weight 474 g/mol
SMILES COC1=C(C=C2C(=C1)C(=NC(=N2)N3CCN(C4C3CCCC4)C(=O)C5=CC=CO5)N)OC.Cl
InChIKey SKDIDWRQDBIQBS-MCJVGQIASA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cyclazosin Hydrochloride (CAS: 146929-33-1)?

Cyclazosin Hydrochloride is a white to off-white crystalline powder. Its molecular formula is C22H27...

Compound Q&A

What industries use Cyclazosin Hydrochloride (CAS: 146929-33-1)?

Cyclazosin Hydrochloride is primarily used in the pharmaceutical industry. It is a vasodilator used ...

Compound Q&A

What precautions should be taken when handling Cyclazosin Hydrochloride (CAS: 146929-33-1)?

When handling Cyclazosin Hydrochloride, wear appropriate personal protective equipment (PPE) includi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...