Compound Q&A

How is 1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6) typically synthesized?

Answer

1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone
1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6) is typically synthesized through the reduction of 1,4-dione-2,3-diphenoxy-9,10-anthraquinone with sodium borohydride or lithium aluminum hydride. The reaction is carried out in a suitable solvent such as dimethylformamide, with careful control of temperature and stirring to ensure selectivity and high yield.

About

CAS No 6408-72-6
English Name 1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone
Molecular Formula C26H18N2O4
Molecular Weight 422.44 g/mol
SMILES c1ccc(cc1)Oc2c(c3c(c(c2Oc4ccccc4)N)C(=O)c5ccccc5C3=O)N
InChIKey NZTGGRGGJFCKGG-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6)?

1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6) is a crystalline compound with a molec...

Compound Q&A

What industries use 1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6)?

1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6)?

When handling 1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6), it is essential to use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...