Compound Q&A

What are the physical and chemical properties of 1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6)?

Answer

1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone
1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6) is a crystalline compound with a molecular weight of approximately 514.23 g/mol. It has a high solubility in dimethylformamide and ethanol but is insoluble in water. This compound is relatively stable under normal conditions but can react with oxidizing agents. It is commonly used in the synthesis of dyes and pigments due to its chromophoric properties.

About

CAS No 6408-72-6
English Name 1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone
Molecular Formula C26H18N2O4
Molecular Weight 422.44 g/mol
SMILES c1ccc(cc1)Oc2c(c3c(c(c2Oc4ccccc4)N)C(=O)c5ccccc5C3=O)N
InChIKey NZTGGRGGJFCKGG-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6) typically synthesized?

1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6) is typically synthesized through the r...

Compound Q&A

What industries use 1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6)?

1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6)?

When handling 1,4-Diamino-2,3-diphenoxy-9,10-anthraquinone (CAS: 6408-72-6), it is essential to use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...