Compound Q&A

What precautions should be taken when handling Neomycin (CAS: 1404-04-2)?

Answer

Neomycin
When handling neomycin (CAS: 1404-04-2), it is essential to follow these safety precautions: wear appropriate personal protective equipment (PPE) including gloves, lab coat, and safety goggles. Store it in a cool, dry place, away from direct sunlight and heat sources. Use a fume hood during operations to minimize inhalation risks. In case of a spill, neutralize it with an appropriate chemical and dispose of properly following safety data sheet (SDS) guidelines. Always consult the SDS for detailed safety information.

About

CAS No 1404-04-2
English Name Neomycin
Molecular Formula C23H46N6O13
Molecular Weight 614.64 g/mol
SMILES C1C(C(C(C(C1N)OC2C(C(C(C(O2)CN)O)O)N)OC3C(C(C(O3)CO)OC4C(C(C(C(O4)CN)O)O)N)O)O)N
InChIKey PGBHMTALBVVCIT-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Neomycin (CAS: 1404-04-2)?

Neomycin (CAS: 1404-04-2) is a white or off-white crystalline powder. Its molecular weight is approx...

Compound Q&A

How is Neomycin (CAS: 1404-04-2) typically synthesized?

Neomycin (CAS: 1404-04-2) is typically synthesized via a fermentation process involving Streptomyces...

Compound Q&A

What industries use Neomycin (CAS: 1404-04-2)?

Neomycin (CAS: 1404-04-2) is widely used in the pharmaceutical industry for its antibiotic propertie...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...