Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [3-(aminomethyl)benzyl]carbamate (CAS: 108467-99-8)?

Answer

2-Methyl-2-propanyl [3-(aminomethyl)benzyl]carbamate
2-Methyl-2-propanyl [3-(aminomethyl)benzyl]carbamate has a crystalline form and a molecular weight of approximately 298.4 g/mol. It is poorly soluble in water but soluble in organic solvents such as ethanol and acetone. Chemically, it is reactive towards nucleophiles and can undergo hydrolysis under basic conditions.

About

English Name 2-Methyl-2-propanyl [3-(aminomethyl)benzyl]carbamate
Molecular Formula C13H20N2O2
Molecular Weight 236.31 g/mol
SMILES CC(C)(C)OC(=O)NCC1=CC=CC(=C1)CN
InChIKey GQAUPTTUSSLXPS-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl [3-(aminomethyl)benzyl]carbamate (CAS: 108467-99-8) typically synthesized?

This compound can be synthesized through a multistep process involving the coupling of an amine with...

Compound Q&A

What industries use 2-Methyl-2-propanyl [3-(aminomethyl)benzyl]carbamate (CAS: 108467-99-8)?

2-Methyl-2-propanyl [3-(aminomethyl)benzyl]carbamate is used in the pharmaceutical industry for inte...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl [3-(aminomethyl)benzyl]carbamate (CAS: 108467-99-8)?

When handling this compound, use appropriate personal protective equipment (PPE) such as gloves, gog...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...