Compound Q&A

How is 2-Propyn-1-yl 4-methylbenzenesulfonate (CAS: 6165-76-0) typically synthesized?

Answer

2-Propyn-1-yl 4-methylbenzenesulfonate
2-Propyn-1-yl 4-methylbenzenesulfonate is typically synthesized by reacting 4-methylbenzenesulfonyl chloride with propargyl alcohol. This reaction requires a suitable base and is carried out in an organic solvent. The yield is generally good, and the product can be isolated by filtration and recrystallization.

About

CAS No 6165-76-0
English Name 2-Propyn-1-yl 4-methylbenzenesulfonate
Molecular Formula C10H10O3S
Molecular Weight 200.26 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OCC#C
InChIKey LMBVCSFXFFROTA-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Propyn-1-yl 4-methylbenzenesulfonate (CAS: 6165-76-0)?

2-Propyn-1-yl 4-methylbenzenesulfonate is a crystalline compound with a molecular weight of approxim...

Compound Q&A

What industries use 2-Propyn-1-yl 4-methylbenzenesulfonate (CAS: 6165-76-0)?

2-Propyn-1-yl 4-methylbenzenesulfonate is used in the pharmaceutical industry for the synthesis of c...

Compound Q&A

What precautions should be taken when handling 2-Propyn-1-yl 4-methylbenzenesulfonate (CAS: 6165-76-0)?

When handling 2-Propyn-1-yl 4-methylbenzenesulfonate, use appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...