Compound Q&A

What are the physical and chemical properties of 2-Propyn-1-yl 4-methylbenzenesulfonate (CAS: 6165-76-0)?

Answer

2-Propyn-1-yl 4-methylbenzenesulfonate
2-Propyn-1-yl 4-methylbenzenesulfonate is a crystalline compound with a molecular weight of approximately 209.23 g/mol. It has a low solubility in water but is more soluble in organic solvents. This compound is relatively stable under normal conditions but can react with strong bases. It is used in various synthetic applications due to its functional groups.

About

CAS No 6165-76-0
English Name 2-Propyn-1-yl 4-methylbenzenesulfonate
Molecular Formula C10H10O3S
Molecular Weight 200.26 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OCC#C
InChIKey LMBVCSFXFFROTA-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2-Propyn-1-yl 4-methylbenzenesulfonate (CAS: 6165-76-0) typically synthesized?

2-Propyn-1-yl 4-methylbenzenesulfonate is typically synthesized by reacting 4-methylbenzenesulfonyl ...

Compound Q&A

What industries use 2-Propyn-1-yl 4-methylbenzenesulfonate (CAS: 6165-76-0)?

2-Propyn-1-yl 4-methylbenzenesulfonate is used in the pharmaceutical industry for the synthesis of c...

Compound Q&A

What precautions should be taken when handling 2-Propyn-1-yl 4-methylbenzenesulfonate (CAS: 6165-76-0)?

When handling 2-Propyn-1-yl 4-methylbenzenesulfonate, use appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...