Compound Q&A

What are the physical and chemical properties of Manganese(3+) chloride 2,2'-{1,2-ethanediylbis[nitrilo(E)methylylidene]}bis(6-methoxyphenolate) (CAS: 81065-76-1)?

Answer

Manganese(3+) chloride 2,2'-{1,2-ethanediylbis[nitrilo(E)methylylidene]}bis(6-methoxyphenolate) (1:1:1)
This compound is a crystalline solid with a molecular weight of approximately 762.35 g/mol. It has limited solubility in water and is highly reactive with reducing agents. The compound exhibits coordination chemistry typical of transition metal complexes.

About

CAS No 81065-76-1
English Name Manganese(3+) chloride 2,2'-{1,2-ethanediylbis[nitrilo(E)methylylidene]}bis(6-methoxyphenolate) (1:1:1)
Molecular Formula C18H18ClMnN2O4
Molecular Weight 416.7 g/mol
SMILES COC1=CC=CC(=C1[O-])C=NCCN=CC2=C(C(=CC=C2)OC)[O-].[Cl-].[Mn+3]
InChIKey YUZJJFWCXJDFOQ-GAMUHHASSA-K
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Manganese(3+) chloride 2,2'-{1,2-ethanediylbis[nitrilo(E)methylylidene]}bis(6-methoxyphenolate) (CAS: 81065-76-1) typically synthesized?

This compound can be synthesized by the reaction of manganese(III) chloride with a 6-methoxyphenolat...

Compound Q&A

What industries use Manganese(3+) chloride 2,2'-{1,2-ethanediylbis[nitrilo(E)methylylidene]}bis(6-methoxyphenolate) (CAS: 81065-76-1)?

This compound is primarily used in the field of analytical chemistry for developing sensors and as a...

Compound Q&A

What precautions should be taken when handling Manganese(3+) chloride 2,2'-{1,2-ethanediylbis[nitrilo(E)methylylidene]}bis(6-methoxyphenolate) (CAS: 81065-76-1)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...