Compound Q&A

What industries use 2-Methyl-2-proanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate (CAS: 173405-78-2)?

Answer

2-Methyl-2-propanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate
2-Methyl-2-proanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate finds applications in the pharmaceutical industry for the synthesis of complex organic molecules, as well as in the polymer industry for the modification of polymer properties. It is also used in the production of sensors and semiconductors, where its unique chemical structure offers specific functionalities. Its versatile chemical properties make it a valuable reagent in various research and industrial settings.

About

English Name 2-Methyl-2-propanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate
Molecular Formula C14H26N2O2
Molecular Weight 254.37 g/mol
SMILES CC(C)(C)OC(=O)N1CCC2(CCNCC2)CC1
InChIKey YLKHACHFJMCIRE-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate (CAS: 173405-78-2)?

2-Methyl-2-propanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate is a crystalline compound with a molec...

Compound Q&A

How is 2-Methyl-2-proanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate (CAS: 173405-78-2) typically synthesized?

2-Methyl-2-proanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate is typically synthesized through a mult...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate (CAS: 173405-78-2)?

When handling 2-Methyl-2-proanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate, it is important to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...