Compound Q&A

How is 2-Methyl-2-proanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate (CAS: 173405-78-2) typically synthesized?

Answer

2-Methyl-2-propanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate
2-Methyl-2-proanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate is typically synthesized through a multistep process involving the formation of a diazepine ring followed by carboxylation. Commonly, this involves the reaction of a suitable amine with a carboxylic acid derivative in the presence of a catalyst, such as an imidazolium salt, to achieve high selectivity and yield. The exact method can vary depending on the starting materials and desired product purity.

About

English Name 2-Methyl-2-propanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate
Molecular Formula C14H26N2O2
Molecular Weight 254.37 g/mol
SMILES CC(C)(C)OC(=O)N1CCC2(CCNCC2)CC1
InChIKey YLKHACHFJMCIRE-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate (CAS: 173405-78-2)?

2-Methyl-2-propanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate is a crystalline compound with a molec...

Compound Q&A

What industries use 2-Methyl-2-proanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate (CAS: 173405-78-2)?

2-Methyl-2-proanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate finds applications in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate (CAS: 173405-78-2)?

When handling 2-Methyl-2-proanyl 3,9-diazaspiro[5.5]undecane-3-carboxylate, it is important to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...