Compound Q&A

What industries use 2-Methyl-2-propanyl (2S,3R)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate (CAS: 112741-50-1)?

Answer

2-Methyl-2-propanyl (2S,3R)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate
This compound is primarily used in the pharmaceutical industry for its role as an intermediate in the synthesis of certain drugs. It is also utilized in the polymer industry for its ability to enhance the properties of certain materials. Additionally, it finds applications in the production of sensors and semiconductor materials due to its unique chemical properties.

About

English Name 2-Methyl-2-propanyl (2S,3R)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate
Molecular Formula C21H23NO4
Molecular Weight 353.42 g/mol
SMILES CC(C)(C)OC(=O)N1CC(=O)OC(C1C2=CC=CC=C2)C3=CC=CC=C3
InChIKey MRUKRSQUUNYOFK-MOPGFXCFSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (2S,3R)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate (CAS: 112741-50-1)?

The compound is a crystalline solid with a high molecular weight. It has low water solubility but is...

Compound Q&A

How is 2-Methyl-2-propanyl (2S,3R)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate (CAS: 112741-50-1) typically synthesized?

The compound is often synthesized via a multi-step process involving the reaction of a phenyl vinyl ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl (2S,3R)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate (CAS: 112741-50-1)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...