Compound Q&A

How is 2-Methyl-2-propanyl (2S,3R)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate (CAS: 112741-50-1) typically synthesized?

Answer

2-Methyl-2-propanyl (2S,3R)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate
The compound is often synthesized via a multi-step process involving the reaction of a phenyl vinyl ketone with a morpholine derivative. The reaction is typically catalyzed by a Lewis acid and proceeds with good selectivity and yield. The process involves careful control of temperature and reaction time to achieve the desired stereochemistry.

About

English Name 2-Methyl-2-propanyl (2S,3R)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate
Molecular Formula C21H23NO4
Molecular Weight 353.42 g/mol
SMILES CC(C)(C)OC(=O)N1CC(=O)OC(C1C2=CC=CC=C2)C3=CC=CC=C3
InChIKey MRUKRSQUUNYOFK-MOPGFXCFSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (2S,3R)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate (CAS: 112741-50-1)?

The compound is a crystalline solid with a high molecular weight. It has low water solubility but is...

Compound Q&A

What industries use 2-Methyl-2-propanyl (2S,3R)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate (CAS: 112741-50-1)?

This compound is primarily used in the pharmaceutical industry for its role as an intermediate in th...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl (2S,3R)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate (CAS: 112741-50-1)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...