Compound Q&A

What industries use 2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9)?

Answer

2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate
2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9) is used in the pharmaceutical industry for the synthesis of bioactive compounds. It is also relevant in the fine chemical sector for the production of speciality chemicals. Its applications in other industries such as polymers and sensors are less common but are explored for their potential in material science.

About

English Name 2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate
Molecular Formula C11H20BrNO2
Molecular Weight 278.19 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC(C1)CBr
InChIKey MGGZYACWICDRRD-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9)?

2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9) is a crystalline comp...

Compound Q&A

How is 2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9) typically synthesized?

2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9) is synthesized throug...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9)?

When handling 2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...