Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9)?

Answer

2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate
2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9) is a crystalline compound with a molecular weight of approximately 286.64 g/mol. It has a moderate solubility in organic solvents like ethanol and poor solubility in water. This compound exhibits limited reactivity under normal conditions but can undergo nucleophilic substitution reactions. It is sensitive to moisture and heat, requiring storage under anhydrous and mild conditions.

About

English Name 2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate
Molecular Formula C11H20BrNO2
Molecular Weight 278.19 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC(C1)CBr
InChIKey MGGZYACWICDRRD-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9) typically synthesized?

2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9) is synthesized throug...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9)?

2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9) is used in the pharma...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9)?

When handling 2-Methyl-2-propanyl 3-(bromomethyl)-1-piperidinecarboxylate (CAS: 193629-39-9), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...