Compound Q&A

How is 6-Bromo-1H-indole-2-carboxylic acid (CAS: 16732-65-3) typically synthesized?

Answer

6-Bromo-1H-indole-2-carboxylic acid
6-Bromo-1H-indole-2-carboxylic acid is typically synthesized via bromination of indole-2-carboxylic acid using N-bromosuccinimide (NBS) in the presence of a suitable oxidizing agent like benzoyl peroxide. The reaction is carried out in a chloroform or dichloromethane solvent at room temperature, yielding a high yield of the desired product with good selectivity.

About

CAS No 16732-65-3
English Name 6-Bromo-1H-indole-2-carboxylic acid
Molecular Formula C9H6BrNO2
Molecular Weight 240.06 g/mol
SMILES C1=CC2=C(C=C1Br)NC(=C2)C(=O)O
InChIKey SVBVYRYROZWKNJ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-1H-indole-2-carboxylic acid (CAS: 16732-65-3)?

6-Bromo-1H-indole-2-carboxylic acid is a white to off-white crystalline solid with a molecular weigh...

Compound Q&A

What industries use 6-Bromo-1H-indole-2-carboxylic acid (CAS: 16732-65-3)?

6-Bromo-1H-indole-2-carboxylic acid is used in the pharmaceutical industry for the synthesis of drug...

Compound Q&A

What precautions should be taken when handling 6-Bromo-1H-indole-2-carboxylic acid (CAS: 16732-65-3)?

Proper handling of 6-Bromo-1H-indole-2-carboxylic acid requires the use of appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...