Compound Q&A

What are the physical and chemical properties of 6-Bromo-1H-indole-2-carboxylic acid (CAS: 16732-65-3)?

Answer

6-Bromo-1H-indole-2-carboxylic acid
6-Bromo-1H-indole-2-carboxylic acid is a white to off-white crystalline solid with a molecular weight of approximately 245.04 g/mol. Its solubility in water is low, while it is more soluble in organic solvents like ethanol and acetone. It is moderately reactive, particularly towards nucleophiles and bases, making it suitable for various organic transformations.

About

CAS No 16732-65-3
English Name 6-Bromo-1H-indole-2-carboxylic acid
Molecular Formula C9H6BrNO2
Molecular Weight 240.06 g/mol
SMILES C1=CC2=C(C=C1Br)NC(=C2)C(=O)O
InChIKey SVBVYRYROZWKNJ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 6-Bromo-1H-indole-2-carboxylic acid (CAS: 16732-65-3) typically synthesized?

6-Bromo-1H-indole-2-carboxylic acid is typically synthesized via bromination of indole-2-carboxylic ...

Compound Q&A

What industries use 6-Bromo-1H-indole-2-carboxylic acid (CAS: 16732-65-3)?

6-Bromo-1H-indole-2-carboxylic acid is used in the pharmaceutical industry for the synthesis of drug...

Compound Q&A

What precautions should be taken when handling 6-Bromo-1H-indole-2-carboxylic acid (CAS: 16732-65-3)?

Proper handling of 6-Bromo-1H-indole-2-carboxylic acid requires the use of appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...