Compound Q&A

What are the physical and chemical properties of 1-Ethyl-3-methyl-1H-imidazol-3-ium hydrogen sulfate (CAS: 412009-61-1)?

Answer

1-Ethyl-3-methyl-1H-imidazol-3-ium hydrogen sulfate
1-Ethyl-3-methyl-1H-imidazol-3-ium hydrogen sulfate is a crystalline solid with a molecular weight of approximately 158.18 g/mol. It has a low solubility in water but is soluble in common organic solvents. The compound is moderately reactive, especially towards bases.

About

English Name 1-Ethyl-3-methyl-1H-imidazol-3-ium hydrogen sulfate
Molecular Formula C6H12N2O4S
Molecular Weight 208.24 g/mol
SMILES CCN1C=C[N+](=C1)C.OS(=O)(=O)[O-]
InChIKey HZKDSQCZNUUQIF-UHFFFAOYSA-M
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 1-Ethyl-3-methyl-1H-imidazol-3-ium hydrogen sulfate (CAS: 412009-61-1) typically synthesized?

1-Ethyl-3-methyl-1H-imidazol-3-ium hydrogen sulfate is usually synthesized via the reaction of 1-eth...

Compound Q&A

What industries use 1-Ethyl-3-methyl-1H-imidazol-3-ium hydrogen sulfate (CAS: 412009-61-1)?

1-Ethyl-3-methyl-1H-imidazol-3-ium hydrogen sulfate finds applications in pharmaceuticals for interm...

Compound Q&A

What precautions should be taken when handling 1-Ethyl-3-methyl-1H-imidazol-3-ium hydrogen sulfate (CAS: 412009-61-1)?

When handling 1-Ethyl-3-methyl-1H-imidazol-3-ium hydrogen sulfate, proper personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...