Compound Q&A

What industries use 2-Methyl-2-propanyl 6-amino-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 164148-92-9)?

Answer

2-Methyl-2-propanyl 6-amino-3,4-dihydro-2(1H)-isoquinolinecarboxylate
This compound is used in pharmaceuticals and fine chemicals due to its biological activity. It may also find applications in the production of certain polymers and as a precursor in the synthesis of other organic compounds.

About

English Name 2-Methyl-2-propanyl 6-amino-3,4-dihydro-2(1H)-isoquinolinecarboxylate
Molecular Formula C14H20N2O2
Molecular Weight 248.33 g/mol
SMILES CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC(=C2)N
InChIKey OLOIFCYZWOTWRO-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 6-amino-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 164148-92-9)?

The compound has a crystalline form with a molecular weight of approximately 308.35 g/mol. It is sli...

Compound Q&A

How is 2-Methyl-2-propanyl 6-amino-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 164148-92-9) typically synthesized?

This compound can be synthesized via a multistep process involving the condensation of 2-methyl-2-pr...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 6-amino-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 164148-92-9)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...