Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 6-amino-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 164148-92-9)?

Answer

2-Methyl-2-propanyl 6-amino-3,4-dihydro-2(1H)-isoquinolinecarboxylate
The compound has a crystalline form with a molecular weight of approximately 308.35 g/mol. It is slightly soluble in water but more soluble in organic solvents. Chemically, it exhibits basic properties due to the amino group and is reactive towards acidic compounds. It is also prone to hydrolysis under basic conditions.

About

English Name 2-Methyl-2-propanyl 6-amino-3,4-dihydro-2(1H)-isoquinolinecarboxylate
Molecular Formula C14H20N2O2
Molecular Weight 248.33 g/mol
SMILES CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC(=C2)N
InChIKey OLOIFCYZWOTWRO-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 6-amino-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 164148-92-9) typically synthesized?

This compound can be synthesized via a multistep process involving the condensation of 2-methyl-2-pr...

Compound Q&A

What industries use 2-Methyl-2-propanyl 6-amino-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 164148-92-9)?

This compound is used in pharmaceuticals and fine chemicals due to its biological activity. It may a...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 6-amino-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 164148-92-9)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...