Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-1,3-benzothiazole (CAS: 3622-23-9)?

Answer

2,6-Dichloro-1,3-benzothiazole
Handling 2,6-Dichloro-1,3-benzothiazole requires careful attention to safety. It should always be handled in a well-ventilated area or fume hood to avoid inhaling its vapor. Wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. In case of a spill, use appropriate materials to contain and dispose of it safely, following the Material Safety Data Sheet (MSDS) guidelines.

About

CAS No 3622-23-9
English Name 2,6-Dichloro-1,3-benzothiazole
Molecular Formula C7H3Cl2NS
Molecular Weight 204.08 g/mol
SMILES C1=CC2=C(C=C1Cl)SC(=N2)Cl
InChIKey QDZGJGWDGLHVNK-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-1,3-benzothiazole (CAS: 3622-23-9)?

2,6-Dichloro-1,3-benzothiazole is a crystalline compound with a molecular weight of 218.03 g/mol. It...

Compound Q&A

How is 2,6-Dichloro-1,3-benzothiazole (CAS: 3622-23-9) typically synthesized?

2,6-Dichloro-1,3-benzothiazole is typically synthesized through the reaction of thiourea and chloros...

Compound Q&A

What industries use 2,6-Dichloro-1,3-benzothiazole (CAS: 3622-23-9)?

2,6-Dichloro-1,3-benzothiazole finds applications in various industries. It is used in the pharmaceu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...